C16H20N4O — CID 81036309
2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carboximidamide (PubChem CID 81036309) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carboximidamide.
| Compound Name | 2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81036309 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(OCCCc2ccncc2)cc(C)nc1C |
| InChI | InChI=1S/C16H20N4O/c1-11-10-14(15(16(17)18)12(2)20-11)21-9-3-4-13-5-7-19-8-6-13/h5-8,10H,3-4,9H2,1-2H3,(H3,17,18) |
| InChIKey | KHFZSNXWTQNFQO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|