C12H16N4OS — CID 106189265
2,6-dimethyl-4-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carbothioamide (PubChem CID 106189265) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 106189265 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2,6-dimethyl-4-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carbothioamide |
| SMILES | Cc1cc(NC2CNC(=O)C2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C12H16N4OS/c1-6-3-9(11(12(13)18)7(2)15-6)16-8-4-10(17)14-5-8/h3,8H,4-5H2,1-2H3,(H2,13,18)(H,14,17)(H,15,16) |
| InChIKey | SFPUOBVPDLGRRV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|