C11H12FN3OS — CID 106189261
5-fluoro-2-[(5-oxopyrrolidin-3-yl)amino]benzenecarbothioamide (PubChem CID 106189261) has the molecular formula C11H12FN3OS and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-fluoro-2-[(5-oxopyrrolidin-3-yl)amino]benzenecarbothioamide.
| Compound Name | 5-fluoro-2-[(5-oxopyrrolidin-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106189261 |
| Molecular Formula | C11H12FN3OS |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-fluoro-2-[(5-oxopyrrolidin-3-yl)amino]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1NC1CNC(=O)C1 |
| InChI | InChI=1S/C11H12FN3OS/c12-6-1-2-9(8(3-6)11(13)17)15-7-4-10(16)14-5-7/h1-3,7,15H,4-5H2,(H2,13,17)(H,14,16) |
| InChIKey | HEKAEXRDUISNQT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|