C13H20N2O3 — CID 103442139
2-[[2-(aminomethyl)-4-methylpiperidin-1-yl]methyl]-5-hydroxypyran-4-one (PubChem CID 103442139) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)-4-methylpiperidin-1-yl]methyl]-5-hydroxypyran-4-one.
| Compound Name | 2-[[2-(aminomethyl)-4-methylpiperidin-1-yl]methyl]-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 103442139 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[[2-(aminomethyl)-4-methylpiperidin-1-yl]methyl]-5-hydroxypyran-4-one |
| SMILES | CC1CCN(Cc2cc(=O)c(O)co2)C(CN)C1 |
| InChI | InChI=1S/C13H20N2O3/c1-9-2-3-15(10(4-9)6-14)7-11-5-12(16)13(17)8-18-11/h5,8-10,17H,2-4,6-7,14H2,1H3 |
| InChIKey | XEGBTFXVKWHMMI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |