C12H15NO6 — CID 112632942
methyl 4-hydroxy-1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate (PubChem CID 112632942) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is methyl 4-hydroxy-1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632942 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | methyl 4-hydroxy-1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1Cc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C12H15NO6/c1-18-12(17)9-2-7(14)4-13(9)5-8-3-10(15)11(16)6-19-8/h3,6-7,9,14,16H,2,4-5H2,1H3 |
| InChIKey | YNKCJUXNLUEBTP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |