C11H15NO4 — CID 112632882
methyl 1-(furan-2-ylmethyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 112632882) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl 1-(furan-2-ylmethyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(furan-2-ylmethyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632882 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl 1-(furan-2-ylmethyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1Cc1ccco1 |
| InChI | InChI=1S/C11H15NO4/c1-15-11(14)10-5-8(13)6-12(10)7-9-3-2-4-16-9/h2-4,8,10,13H,5-7H2,1H3 |
| InChIKey | ULSJLAMENAQZHV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |