C12H15NO5 — CID 60597208
methyl 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate (PubChem CID 60597208) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 60597208 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | methyl 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1Cc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C12H15NO5/c1-17-12(16)9-3-2-4-13(9)6-8-5-10(14)11(15)7-18-8/h5,7,9,15H,2-4,6H2,1H3 |
| InChIKey | KEGLJBDLJZGDKB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |