C18H11Cl2F4N5O — CID 10344217
2-(3,5-dichloroanilino)-N-[(2-fluoro-4-pyridinyl)methyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10344217) has the molecular formula C18H11Cl2F4N5O and a molecular weight of 460.22 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-N-[(2-fluoro-4-pyridinyl)methyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3,5-dichloroanilino)-N-[(2-fluoro-4-pyridinyl)methyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10344217 |
| Molecular Formula | C18H11Cl2F4N5O |
| Molecular Weight | 460.22 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2-(3,5-dichloroanilino)-N-[(2-fluoro-4-pyridinyl)methyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccnc(F)c1)c1cnc(Nc2cc(Cl)cc(Cl)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C18H11Cl2F4N5O/c19-10-4-11(20)6-12(5-10)28-17-27-8-13(15(29-17)18(22,23)24)16(30)26-7-9-1-2-25-14(21)3-9/h1-6,8H,7H2,(H,26,30)(H,27,28,29) |
| InChIKey | JITPJBTZUDNWTM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.22 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|