C28H36N2O4 — CID 10344390
4-[bis[6-[(1S)-1-hydroxy-2,2-dimethylpropyl]-2-pyridinyl]-methoxymethyl]phenol (PubChem CID 10344390) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-[bis[6-[(1S)-1-hydroxy-2,2-dimethylpropyl]-2-pyridinyl]-methoxymethyl]phenol.
| Compound Name | 4-[bis[6-[(1S)-1-hydroxy-2,2-dimethylpropyl]-2-pyridinyl]-methoxymethyl]phenol |
|---|---|
| PubChem CID | 10344390 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 4-[bis[6-[(1S)-1-hydroxy-2,2-dimethylpropyl]-2-pyridinyl]-methoxymethyl]phenol |
| SMILES | COC(c1ccc(O)cc1)(c1cccc([C@@H](O)C(C)(C)C)n1)c1cccc([C@@H](O)C(C)(C)C)n1 |
| InChI | InChI=1S/C28H36N2O4/c1-26(2,3)24(32)20-10-8-12-22(29-20)28(34-7,18-14-16-19(31)17-15-18)23-13-9-11-21(30-23)25(33)27(4,5)6/h8-17,24-25,31-33H,1-7H3/t24-,25-/m1/s1 |
| InChIKey | NXVGAQWQZIMBNE-JWQCQUIFSA-N |
| XLogP | 5.28 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |