C13H16Cl2N4O — CID 103444104
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-chloro-2-pyridinyl)-N-methylmethanamine (PubChem CID 103444104) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-chloro-2-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-chloro-2-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103444104 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-chloro-2-pyridinyl)-N-methylmethanamine |
| SMILES | CNC(c1ncccc1Cl)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C13H16Cl2N4O/c1-16-12(11-9(14)4-3-5-17-11)13-10(15)8-18-19(13)6-7-20-2/h3-5,8,12,16H,6-7H2,1-2H3 |
| InChIKey | HXWJBVYVMSZZIL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |