C15H20Cl2N4 — CID 103444702
N-[(4-chloro-1-propylpyrazol-5-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine (PubChem CID 103444702) has the molecular formula C15H20Cl2N4 and a molecular weight of 327.26 g/mol. Its IUPAC name is N-[(4-chloro-1-propylpyrazol-5-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(4-chloro-1-propylpyrazol-5-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103444702 |
| Molecular Formula | C15H20Cl2N4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[(4-chloro-1-propylpyrazol-5-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ncccc1Cl)c1c(Cl)cnn1CCC |
| InChI | InChI=1S/C15H20Cl2N4/c1-3-7-18-14(13-11(16)6-5-8-19-13)15-12(17)10-20-21(15)9-4-2/h5-6,8,10,14,18H,3-4,7,9H2,1-2H3 |
| InChIKey | LFCFLSNZXGFBQM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |