C15H14ClF3N2 — CID 103444525
N-[(3-chloro-2-pyridinyl)-[3-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 103444525) has the molecular formula C15H14ClF3N2 and a molecular weight of 314.74 g/mol. Its IUPAC name is N-[(3-chloro-2-pyridinyl)-[3-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | N-[(3-chloro-2-pyridinyl)-[3-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103444525 |
| Molecular Formula | C15H14ClF3N2 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-[(3-chloro-2-pyridinyl)-[3-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1cccc(C(F)(F)F)c1)c1ncccc1Cl |
| InChI | InChI=1S/C15H14ClF3N2/c1-2-20-13(14-12(16)7-4-8-21-14)10-5-3-6-11(9-10)15(17,18)19/h3-9,13,20H,2H2,1H3 |
| InChIKey | QURSDHHGSFWOJM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |