C14H12ClF3N2S — CID 64631082
2-[(3-chloro-2-pyridinyl)sulfanyl]-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 64631082) has the molecular formula C14H12ClF3N2S and a molecular weight of 332.78 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64631082 |
| Molecular Formula | C14H12ClF3N2S |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NC(CSc1ncccc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12ClF3N2S/c15-11-5-2-6-20-13(11)21-8-12(19)9-3-1-4-10(7-9)14(16,17)18/h1-7,12H,8,19H2 |
| InChIKey | GYJFLTFZAQNPRW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |