C13H19FO3 — CID 103449386
2-ethyl-1-(3-fluoro-4-methoxyphenyl)butane-1,2-diol (PubChem CID 103449386) has the molecular formula C13H19FO3 and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-ethyl-1-(3-fluoro-4-methoxyphenyl)butane-1,2-diol.
| Compound Name | 2-ethyl-1-(3-fluoro-4-methoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 103449386 |
| Molecular Formula | C13H19FO3 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-ethyl-1-(3-fluoro-4-methoxyphenyl)butane-1,2-diol |
| SMILES | CCC(O)(CC)C(O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H19FO3/c1-4-13(16,5-2)12(15)9-6-7-11(17-3)10(14)8-9/h6-8,12,15-16H,4-5H2,1-3H3 |
| InChIKey | WDVCHSNJMGCOJX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |