C15H24BrN3O2 — CID 103450851
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(1-hydroxy-4-methylcyclohexyl)methanone (PubChem CID 103450851) has the molecular formula C15H24BrN3O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(1-hydroxy-4-methylcyclohexyl)methanone.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(1-hydroxy-4-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 103450851 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(1-hydroxy-4-methylcyclohexyl)methanone |
| SMILES | CC1CCC(O)(C(=O)c2c(Br)cnn2CCN(C)C)CC1 |
| InChI | InChI=1S/C15H24BrN3O2/c1-11-4-6-15(21,7-5-11)14(20)13-12(16)10-17-19(13)9-8-18(2)3/h10-11,21H,4-9H2,1-3H3 |
| InChIKey | CUOVFOLNTDUHAX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |