C12H18BrN3O2 — CID 114640598
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(oxolan-3-yl)methanone (PubChem CID 114640598) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(oxolan-3-yl)methanone.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 114640598 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(oxolan-3-yl)methanone |
| SMILES | CN(C)CCn1ncc(Br)c1C(=O)C1CCOC1 |
| InChI | InChI=1S/C12H18BrN3O2/c1-15(2)4-5-16-11(10(13)7-14-16)12(17)9-3-6-18-8-9/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | OGHITNHQQXYNDZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |