C14H23N3O3 — CID 114640631
[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(oxan-3-yl)methanone (PubChem CID 114640631) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(oxan-3-yl)methanone.
| Compound Name | [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(oxan-3-yl)methanone |
|---|---|
| PubChem CID | 114640631 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(oxan-3-yl)methanone |
| SMILES | COc1cnn(CCN(C)C)c1C(=O)C1CCCOC1 |
| InChI | InChI=1S/C14H23N3O3/c1-16(2)6-7-17-13(12(19-3)9-15-17)14(18)11-5-4-8-20-10-11/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | IWQDBYVJZAMTCO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |