C28H41N3O2S — CID 10345208
1-methylsulfonyl-4-[1-phenyl-3-[4-(3-phenylpropyl)piperidin-1-yl]propyl]piperazine (PubChem CID 10345208) has the molecular formula C28H41N3O2S and a molecular weight of 483.72 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[1-phenyl-3-[4-(3-phenylpropyl)piperidin-1-yl]propyl]piperazine.
| Compound Name | 1-methylsulfonyl-4-[1-phenyl-3-[4-(3-phenylpropyl)piperidin-1-yl]propyl]piperazine |
|---|---|
| PubChem CID | 10345208 |
| Molecular Formula | C28H41N3O2S |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 1-methylsulfonyl-4-[1-phenyl-3-[4-(3-phenylpropyl)piperidin-1-yl]propyl]piperazine |
| SMILES | CS(=O)(=O)N1CCN(C(CCN2CCC(CCCc3ccccc3)CC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H41N3O2S/c1-34(32,33)31-23-21-30(22-24-31)28(27-13-6-3-7-14-27)17-20-29-18-15-26(16-19-29)12-8-11-25-9-4-2-5-10-25/h2-7,9-10,13-14,26,28H,8,11-12,15-24H2,1H3 |
| InChIKey | OTAUBUBNDOUOFU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |