C23H30ClNO4S2 — CID 58694767
1-(3-chloro-3-phenylpropyl)-4-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine (PubChem CID 58694767) has the molecular formula C23H30ClNO4S2 and a molecular weight of 484.08 g/mol. Its IUPAC name is 1-(3-chloro-3-phenylpropyl)-4-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine.
| Compound Name | 1-(3-chloro-3-phenylpropyl)-4-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine |
|---|---|
| PubChem CID | 58694767 |
| Molecular Formula | C23H30ClNO4S2 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 1-(3-chloro-3-phenylpropyl)-4-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)CCC2CCN(CCC(Cl)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H30ClNO4S2/c1-30(26,27)21-7-9-22(10-8-21)31(28,29)18-14-19-11-15-25(16-12-19)17-13-23(24)20-5-3-2-4-6-20/h2-10,19,23H,11-18H2,1H3 |
| InChIKey | BFTULQSBHLGVEU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|