C16H25NO2S — CID 18342648
4-[2-(benzenesulfonyl)ethyl]-1-propan-2-ylpiperidine (PubChem CID 18342648) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 4-[2-(benzenesulfonyl)ethyl]-1-propan-2-ylpiperidine.
| Compound Name | 4-[2-(benzenesulfonyl)ethyl]-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 18342648 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-[2-(benzenesulfonyl)ethyl]-1-propan-2-ylpiperidine |
| SMILES | CC(C)N1CCC(CCS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H25NO2S/c1-14(2)17-11-8-15(9-12-17)10-13-20(18,19)16-6-4-3-5-7-16/h3-7,14-15H,8-13H2,1-2H3 |
| InChIKey | ORTBCUPWAMAQKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |