C9H15ClN2O2 — CID 103452617
1-(4-chloro-1-propylpyrazol-5-yl)propane-1,2-diol (PubChem CID 103452617) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is 1-(4-chloro-1-propylpyrazol-5-yl)propane-1,2-diol.
| Compound Name | 1-(4-chloro-1-propylpyrazol-5-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 103452617 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(4-chloro-1-propylpyrazol-5-yl)propane-1,2-diol |
| SMILES | CCCn1ncc(Cl)c1C(O)C(C)O |
| InChI | InChI=1S/C9H15ClN2O2/c1-3-4-12-8(7(10)5-11-12)9(14)6(2)13/h5-6,9,13-14H,3-4H2,1-2H3 |
| InChIKey | KLWMSXSKAXWAKY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |