C12H19NO3 — CID 103454750
1-(5-propoxy-3-pyridinyl)butane-1,2-diol (PubChem CID 103454750) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-(5-propoxy-3-pyridinyl)butane-1,2-diol.
| Compound Name | 1-(5-propoxy-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 103454750 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 1-(5-propoxy-3-pyridinyl)butane-1,2-diol |
| SMILES | CCCOc1cncc(C(O)C(O)CC)c1 |
| InChI | InChI=1S/C12H19NO3/c1-3-5-16-10-6-9(7-13-8-10)12(15)11(14)4-2/h6-8,11-12,14-15H,3-5H2,1-2H3 |
| InChIKey | HNUZPLVZLAFBAO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |