C9H13BrO2S — CID 103454860
1-(3-bromothiophen-2-yl)pentane-1,2-diol (PubChem CID 103454860) has the molecular formula C9H13BrO2S and a molecular weight of 265.17 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)pentane-1,2-diol.
| Compound Name | 1-(3-bromothiophen-2-yl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103454860 |
| Molecular Formula | C9H13BrO2S |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)c1sccc1Br |
| InChI | InChI=1S/C9H13BrO2S/c1-2-3-7(11)8(12)9-6(10)4-5-13-9/h4-5,7-8,11-12H,2-3H2,1H3 |
| InChIKey | ZTVLOPAMGFSMJX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |