C12H11BrO2S — CID 103459382
1-(3-bromothiophen-2-yl)-2-phenylethane-1,2-diol (PubChem CID 103459382) has the molecular formula C12H11BrO2S and a molecular weight of 299.19 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-phenylethane-1,2-diol.
| Compound Name | 1-(3-bromothiophen-2-yl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 103459382 |
| Molecular Formula | C12H11BrO2S |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-phenylethane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)c1sccc1Br |
| InChI | InChI=1S/C12H11BrO2S/c13-9-6-7-16-12(9)11(15)10(14)8-4-2-1-3-5-8/h1-7,10-11,14-15H |
| InChIKey | KQHWPFFBSLQQSN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |