C11H22O3 — CID 103455135
3-hydroxy-7-methoxy-2,7-dimethyloctan-4-one (PubChem CID 103455135) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 3-hydroxy-7-methoxy-2,7-dimethyloctan-4-one.
| Compound Name | 3-hydroxy-7-methoxy-2,7-dimethyloctan-4-one |
|---|---|
| PubChem CID | 103455135 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 3-hydroxy-7-methoxy-2,7-dimethyloctan-4-one |
| SMILES | COC(C)(C)CCC(=O)C(O)C(C)C |
| InChI | InChI=1S/C11H22O3/c1-8(2)10(13)9(12)6-7-11(3,4)14-5/h8,10,13H,6-7H2,1-5H3 |
| InChIKey | DEOPDUAMFMVIRS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |