C14H28O3 — CID 103035435
3-ethoxy-7-methoxy-2,2,7-trimethyloctan-4-one (PubChem CID 103035435) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 3-ethoxy-7-methoxy-2,2,7-trimethyloctan-4-one.
| Compound Name | 3-ethoxy-7-methoxy-2,2,7-trimethyloctan-4-one |
|---|---|
| PubChem CID | 103035435 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-ethoxy-7-methoxy-2,2,7-trimethyloctan-4-one |
| SMILES | CCOC(C(=O)CCC(C)(C)OC)C(C)(C)C |
| InChI | InChI=1S/C14H28O3/c1-8-17-12(13(2,3)4)11(15)9-10-14(5,6)16-7/h12H,8-10H2,1-7H3 |
| InChIKey | ZQRSKLDYDCAKCL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |