C15H18O2 — CID 103455479
1-(2,3-dihydro-1-benzofuran-5-yl)-5-methylhex-4-en-3-one (PubChem CID 103455479) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-5-methylhex-4-en-3-one.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-5-methylhex-4-en-3-one |
|---|---|
| PubChem CID | 103455479 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-5-methylhex-4-en-3-one |
| SMILES | CC(C)=CC(=O)CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H18O2/c1-11(2)9-14(16)5-3-12-4-6-15-13(10-12)7-8-17-15/h4,6,9-10H,3,5,7-8H2,1-2H3 |
| InChIKey | QDMSFDPQEMNXSK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|