C19H19NO3 — CID 53352123
N-(4-acetylphenyl)-3-(2,3-dihydro-1-benzofuran-5-yl)propanamide (PubChem CID 53352123) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(4-acetylphenyl)-3-(2,3-dihydro-1-benzofuran-5-yl)propanamide.
| Compound Name | N-(4-acetylphenyl)-3-(2,3-dihydro-1-benzofuran-5-yl)propanamide |
|---|---|
| PubChem CID | 53352123 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-(4-acetylphenyl)-3-(2,3-dihydro-1-benzofuran-5-yl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CCc2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-13(21)15-4-6-17(7-5-15)20-19(22)9-3-14-2-8-18-16(12-14)10-11-23-18/h2,4-8,12H,3,9-11H2,1H3,(H,20,22) |
| InChIKey | DPHVBBBGFLAPPF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |