C12H12BrFO2 — CID 103455829
3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-hydroxypropan-2-one (PubChem CID 103455829) has the molecular formula C12H12BrFO2 and a molecular weight of 287.13 g/mol. Its IUPAC name is 3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-hydroxypropan-2-one.
| Compound Name | 3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 103455829 |
| Molecular Formula | C12H12BrFO2 |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-hydroxypropan-2-one |
| SMILES | O=C(Cc1cc(F)cc(Br)c1)C(O)C1CC1 |
| InChI | InChI=1S/C12H12BrFO2/c13-9-3-7(4-10(14)6-9)5-11(15)12(16)8-1-2-8/h3-4,6,8,12,16H,1-2,5H2 |
| InChIKey | OSYHWQBACYYJHY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |