C14H14BrFO — CID 115786828
1-(6-bicyclo[3.1.0]hexanyl)-2-(3-bromo-5-fluorophenyl)ethanone (PubChem CID 115786828) has the molecular formula C14H14BrFO and a molecular weight of 297.17 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-2-(3-bromo-5-fluorophenyl)ethanone.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(3-bromo-5-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 115786828 |
| Molecular Formula | C14H14BrFO |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(3-bromo-5-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)cc(Br)c1)C1C2CCCC21 |
| InChI | InChI=1S/C14H14BrFO/c15-9-4-8(5-10(16)7-9)6-13(17)14-11-2-1-3-12(11)14/h4-5,7,11-12,14H,1-3,6H2 |
| InChIKey | BGPQFKPJDKQGIO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |