C12H15FO2 — CID 103456290
1-(2-fluorophenyl)-2-hydroxy-3,3-dimethylbutan-1-one (PubChem CID 103456290) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-hydroxy-3,3-dimethylbutan-1-one.
| Compound Name | 1-(2-fluorophenyl)-2-hydroxy-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 103456290 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(2-fluorophenyl)-2-hydroxy-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)C(O)C(=O)c1ccccc1F |
| InChI | InChI=1S/C12H15FO2/c1-12(2,3)11(15)10(14)8-6-4-5-7-9(8)13/h4-7,11,15H,1-3H3 |
| InChIKey | WTWMZCPMKHRQSO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |