C14H14F2O — CID 103457718
2-cyclohexylidene-1-(3,5-difluorophenyl)ethanone (PubChem CID 103457718) has the molecular formula C14H14F2O and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-cyclohexylidene-1-(3,5-difluorophenyl)ethanone.
| Compound Name | 2-cyclohexylidene-1-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 103457718 |
| Molecular Formula | C14H14F2O |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-cyclohexylidene-1-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(C=C1CCCCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H14F2O/c15-12-7-11(8-13(16)9-12)14(17)6-10-4-2-1-3-5-10/h6-9H,1-5H2 |
| InChIKey | VKNLORGQPFEDBQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|