C28H25N3O4S — CID 10345851
methyl 3-(benzoylcarbamothioylamino)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrrole-2-carboxylate (PubChem CID 10345851) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is methyl 3-(benzoylcarbamothioylamino)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 3-(benzoylcarbamothioylamino)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10345851 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | methyl 3-(benzoylcarbamothioylamino)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]cc(Cc2ccccc2OCc2ccccc2)c1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H25N3O4S/c1-34-27(33)25-24(30-28(36)31-26(32)20-12-6-3-7-13-20)22(17-29-25)16-21-14-8-9-15-23(21)35-18-19-10-4-2-5-11-19/h2-15,17,29H,16,18H2,1H3,(H2,30,31,32,36) |
| InChIKey | KUIJSBICEKSQLJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|