C11H17N3O — CID 103458861
4-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)hex-3-en-2-one (PubChem CID 103458861) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)hex-3-en-2-one.
| Compound Name | 4-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)hex-3-en-2-one |
|---|---|
| PubChem CID | 103458861 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)hex-3-en-2-one |
| SMILES | CCC(=CC(=O)Cc1ncnn1C)CC |
| InChI | InChI=1S/C11H17N3O/c1-4-9(5-2)6-10(15)7-11-12-8-13-14(11)3/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | BERQUJNQTPTGKZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|