C14H22N2O2 — CID 103458996
1-(2-amino-4-methyl-3-pyridinyl)-2-cyclohexylethane-1,2-diol (PubChem CID 103458996) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2-amino-4-methyl-3-pyridinyl)-2-cyclohexylethane-1,2-diol.
| Compound Name | 1-(2-amino-4-methyl-3-pyridinyl)-2-cyclohexylethane-1,2-diol |
|---|---|
| PubChem CID | 103458996 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(2-amino-4-methyl-3-pyridinyl)-2-cyclohexylethane-1,2-diol |
| SMILES | Cc1ccnc(N)c1C(O)C(O)C1CCCCC1 |
| InChI | InChI=1S/C14H22N2O2/c1-9-7-8-16-14(15)11(9)13(18)12(17)10-5-3-2-4-6-10/h7-8,10,12-13,17-18H,2-6H2,1H3,(H2,15,16) |
| InChIKey | CODSEKOETBNHSL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |