C13H21ClN2O2 — CID 103459014
1-(4-chloro-1-ethylpyrazol-5-yl)-2-cyclohexylethane-1,2-diol (PubChem CID 103459014) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-cyclohexylethane-1,2-diol.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-cyclohexylethane-1,2-diol |
|---|---|
| PubChem CID | 103459014 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-cyclohexylethane-1,2-diol |
| SMILES | CCn1ncc(Cl)c1C(O)C(O)C1CCCCC1 |
| InChI | InChI=1S/C13H21ClN2O2/c1-2-16-11(10(14)8-15-16)13(18)12(17)9-6-4-3-5-7-9/h8-9,12-13,17-18H,2-7H2,1H3 |
| InChIKey | GJCABGPXMDPEAD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |