C10H16ClN3O — CID 114665852
1-(4-chloro-1-ethylpyrazol-5-yl)-2-(cyclopropylamino)ethanol (PubChem CID 114665852) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(cyclopropylamino)ethanol.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(cyclopropylamino)ethanol |
|---|---|
| PubChem CID | 114665852 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(cyclopropylamino)ethanol |
| SMILES | CCn1ncc(Cl)c1C(O)CNC1CC1 |
| InChI | InChI=1S/C10H16ClN3O/c1-2-14-10(8(11)5-13-14)9(15)6-12-7-3-4-7/h5,7,9,12,15H,2-4,6H2,1H3 |
| InChIKey | DMUOUBYSWSKRKC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |