C13H13Cl3N2O — CID 114643302
1-(4-chloro-1-ethylpyrazol-5-yl)-2-(3,4-dichlorophenyl)ethanol (PubChem CID 114643302) has the molecular formula C13H13Cl3N2O and a molecular weight of 319.62 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 114643302 |
| Molecular Formula | C13H13Cl3N2O |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(3,4-dichlorophenyl)ethanol |
| SMILES | CCn1ncc(Cl)c1C(O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl3N2O/c1-2-18-13(11(16)7-17-18)12(19)6-8-3-4-9(14)10(15)5-8/h3-5,7,12,19H,2,6H2,1H3 |
| InChIKey | CSJZJHZZZIPTHZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |