C9H15ClN2O2 — CID 114644164
1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethoxyethanol (PubChem CID 114644164) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethoxyethanol.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethoxyethanol |
|---|---|
| PubChem CID | 114644164 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethoxyethanol |
| SMILES | CCOCC(O)c1c(Cl)cnn1CC |
| InChI | InChI=1S/C9H15ClN2O2/c1-3-12-9(7(10)5-11-12)8(13)6-14-4-2/h5,8,13H,3-4,6H2,1-2H3 |
| InChIKey | RMDBQHYXRAIPQI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |