C17H21NO2 — CID 103459285
1-cyclohexyl-2-quinolin-5-ylethane-1,2-diol (PubChem CID 103459285) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-cyclohexyl-2-quinolin-5-ylethane-1,2-diol.
| Compound Name | 1-cyclohexyl-2-quinolin-5-ylethane-1,2-diol |
|---|---|
| PubChem CID | 103459285 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-cyclohexyl-2-quinolin-5-ylethane-1,2-diol |
| SMILES | OC(c1cccc2ncccc12)C(O)C1CCCCC1 |
| InChI | InChI=1S/C17H21NO2/c19-16(12-6-2-1-3-7-12)17(20)14-8-4-10-15-13(14)9-5-11-18-15/h4-5,8-12,16-17,19-20H,1-3,6-7H2 |
| InChIKey | MJEDIZGDKKHMQO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |