C19H17NO — CID 81209914
2,3-dihydro-1H-inden-2-yl(quinolin-5-yl)methanol (PubChem CID 81209914) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl(quinolin-5-yl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-2-yl(quinolin-5-yl)methanol |
|---|---|
| PubChem CID | 81209914 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl(quinolin-5-yl)methanol |
| SMILES | OC(c1cccc2ncccc12)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C19H17NO/c21-19(15-11-13-5-1-2-6-14(13)12-15)17-7-3-9-18-16(17)8-4-10-20-18/h1-10,15,19,21H,11-12H2 |
| InChIKey | WNIANOGYFNXDCO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |