About (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid
(E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid (PubChem CID 103463288) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid |
| PubChem CID | 103463288 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid |
| SMILES | CCC(C)(C)CNC(=O)Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-4-16(2,3)11-17-15(21)18-13-8-5-12(6-9-13)7-10-14(19)20/h5-10H,4,11H2,1-3H3,(H,19,20)(H2,17,18,21)/b10-7+ |
| InChIKey | XDEZFWWNGULYSF-JXMROGBWSA-N |
| XLogP | 3.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid (CID 103463288) is (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid is CCC(C)(C)CNC(=O)Nc1ccc(/C=C/C(=O)O)cc1.
What is the InChIKey of (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid?
The InChIKey is XDEZFWWNGULYSF-JXMROGBWSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-4-16(2,3)11-17-15(21)18-13-8-5-12(6-9-13)7-10-14(19)20/h5-10H,4,11H2,1-3H3,(H,19,20)(H2,17,18,21)/b10-7+.
What are the key properties of (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid?
(E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid has a molecular weight of 290.36 g/mol, XLogP of 3.34, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[4-(2,2-dimethylbutylcarbamoylamino)phenyl]prop-2-enoic acid is sourced from PubChem (CID 103463288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).