C13H12N2O3 — CID 61192820
3-[4-(prop-2-ynylcarbamoylamino)phenyl]prop-2-enoic acid (PubChem CID 61192820) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[4-(prop-2-ynylcarbamoylamino)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(prop-2-ynylcarbamoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 61192820 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[4-(prop-2-ynylcarbamoylamino)phenyl]prop-2-enoic acid |
| SMILES | C#CCNC(=O)Nc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C13H12N2O3/c1-2-9-14-13(18)15-11-6-3-10(4-7-11)5-8-12(16)17/h1,3-8H,9H2,(H,16,17)(H2,14,15,18) |
| InChIKey | QFWYSOZIJIFOTC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|