C11H12N2O4S — CID 134212893
methyl 4-(prop-2-ynylcarbamoylamino)benzenesulfonate (PubChem CID 134212893) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl 4-(prop-2-ynylcarbamoylamino)benzenesulfonate.
| Compound Name | methyl 4-(prop-2-ynylcarbamoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 134212893 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | methyl 4-(prop-2-ynylcarbamoylamino)benzenesulfonate |
| SMILES | C#CCNC(=O)Nc1ccc(S(=O)(=O)OC)cc1 |
| InChI | InChI=1S/C11H12N2O4S/c1-3-8-12-11(14)13-9-4-6-10(7-5-9)18(15,16)17-2/h1,4-7H,8H2,2H3,(H2,12,13,14) |
| InChIKey | ZFWRVPBSHVDHOY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|