C26H34N3O6P — CID 10346429
(2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]propanoic acid (PubChem CID 10346429) has the molecular formula C26H34N3O6P and a molecular weight of 515.55 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10346429 |
| Molecular Formula | C26H34N3O6P |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]propanoic acid |
| SMILES | CC(C)C[C@H](NC(CCc1ccccc1)P(=O)(O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H34N3O6P/c1-17(2)14-22(28-24(36(33,34)35)13-12-18-8-4-3-5-9-18)25(30)29-23(26(31)32)15-19-16-27-21-11-7-6-10-20(19)21/h3-11,16-17,22-24,27-28H,12-15H2,1-2H3,(H,29,30)(H,31,32)(H2,33,34,35)/t22-,23-,24?/m0/s1 |
| InChIKey | BGHPOLZHWXBMGO-NTZARQNWSA-N |
| XLogP | 3.42 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|