C18H26N3O5P — CID 20719115
[1-[(2-acetamido-4-methylpentanoyl)amino]-2-(1H-indol-3-yl)ethyl]phosphonic acid (PubChem CID 20719115) has the molecular formula C18H26N3O5P and a molecular weight of 395.40 g/mol. Its IUPAC name is [1-[(2-acetamido-4-methylpentanoyl)amino]-2-(1H-indol-3-yl)ethyl]phosphonic acid.
| Compound Name | [1-[(2-acetamido-4-methylpentanoyl)amino]-2-(1H-indol-3-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 20719115 |
| Molecular Formula | C18H26N3O5P |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [1-[(2-acetamido-4-methylpentanoyl)amino]-2-(1H-indol-3-yl)ethyl]phosphonic acid |
| SMILES | CC(=O)NC(CC(C)C)C(=O)NC(Cc1c[nH]c2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C18H26N3O5P/c1-11(2)8-16(20-12(3)22)18(23)21-17(27(24,25)26)9-13-10-19-15-7-5-4-6-14(13)15/h4-7,10-11,16-17,19H,8-9H2,1-3H3,(H,20,22)(H,21,23)(H2,24,25,26) |
| InChIKey | VSHPXYNYOPDWCJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|