C20H28N3O3P — CID 20731952
N-[1-[1-(1H-indol-3-yl)pent-3-yn-2-ylamino]-4-methyl-1-oxopentan-2-yl]-methylphosphonamidic acid (PubChem CID 20731952) has the molecular formula C20H28N3O3P and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[1-[1-(1H-indol-3-yl)pent-3-yn-2-ylamino]-4-methyl-1-oxopentan-2-yl]-methylphosphonamidic acid.
| Compound Name | N-[1-[1-(1H-indol-3-yl)pent-3-yn-2-ylamino]-4-methyl-1-oxopentan-2-yl]-methylphosphonamidic acid |
|---|---|
| PubChem CID | 20731952 |
| Molecular Formula | C20H28N3O3P |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[1-[1-(1H-indol-3-yl)pent-3-yn-2-ylamino]-4-methyl-1-oxopentan-2-yl]-methylphosphonamidic acid |
| SMILES | CC#CC(Cc1c[nH]c2ccccc12)NC(=O)C(CC(C)C)NP(C)(=O)O |
| InChI | InChI=1S/C20H28N3O3P/c1-5-8-16(12-15-13-21-18-10-7-6-9-17(15)18)22-20(24)19(11-14(2)3)23-27(4,25)26/h6-7,9-10,13-14,16,19,21H,11-12H2,1-4H3,(H,22,24)(H2,23,25,26) |
| InChIKey | QQWVIMIBVRNPQB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|