C26H28N2O6S2 — CID 10346856
1-[2-[[2-(2-carboxypiperidine-1-carbonyl)phenyl]disulfanyl]benzoyl]piperidine-2-carboxylic acid (PubChem CID 10346856) has the molecular formula C26H28N2O6S2 and a molecular weight of 528.65 g/mol. Its IUPAC name is 1-[2-[[2-(2-carboxypiperidine-1-carbonyl)phenyl]disulfanyl]benzoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-(2-carboxypiperidine-1-carbonyl)phenyl]disulfanyl]benzoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10346856 |
| Molecular Formula | C26H28N2O6S2 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-[2-[[2-(2-carboxypiperidine-1-carbonyl)phenyl]disulfanyl]benzoyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)c1ccccc1SSc1ccccc1C(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C26H28N2O6S2/c29-23(27-15-7-5-11-19(27)25(31)32)17-9-1-3-13-21(17)35-36-22-14-4-2-10-18(22)24(30)28-16-8-6-12-20(28)26(33)34/h1-4,9-10,13-14,19-20H,5-8,11-12,15-16H2,(H,31,32)(H,33,34) |
| InChIKey | FJYWCFXEIDXLTC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|