C13H15NO3S — CID 10422982
1-(2-sulfanylbenzoyl)piperidine-2-carboxylic acid (PubChem CID 10422982) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-(2-sulfanylbenzoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(2-sulfanylbenzoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10422982 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-(2-sulfanylbenzoyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)c1ccccc1S |
| InChI | InChI=1S/C13H15NO3S/c15-12(9-5-1-2-7-11(9)18)14-8-4-3-6-10(14)13(16)17/h1-2,5,7,10,18H,3-4,6,8H2,(H,16,17) |
| InChIKey | YZFCMYRVYTVPRZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|