(2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid

C12H13NO5 — CID 104894003

IUPAC(2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@H]1CCCN1C(=O)c1cccc(O)c1O
InChIInChI=1S/C12H13NO5/c14-9-5-1-3-7(10(9)15)11(16)13-6-2-4-8(13)12(17)18/h1,3,5,8,14-15H,2,4,6H2,(H,17,18)/t8-/m1/s1
InChIKeySZIXXBPCHUOKDH-MRVPVSSYSA-N
MW251.24 g/mol
LogP0.79
Rot. Bonds2

About (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid

(2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 104894003) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid
PubChem CID104894003
Molecular FormulaC12H13NO5
Molecular Weight251.24 g/mol
Exact Mass251.08
IUPAC Name(2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@H]1CCCN1C(=O)c1cccc(O)c1O
InChIInChI=1S/C12H13NO5/c14-9-5-1-3-7(10(9)15)11(16)13-6-2-4-8(13)12(17)18/h1,3,5,8,14-15H,2,4,6H2,(H,17,18)/t8-/m1/s1
InChIKeySZIXXBPCHUOKDH-MRVPVSSYSA-N
XLogP0.79
TPSA98.07 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.24
LogP ≤ 50.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid (CID 104894003) is (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid is O=C(O)[C@H]1CCCN1C(=O)c1cccc(O)c1O.
What is the InChIKey of (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid?
The InChIKey is SZIXXBPCHUOKDH-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H13NO5/c14-9-5-1-3-7(10(9)15)11(16)13-6-2-4-8(13)12(17)18/h1,3,5,8,14-15H,2,4,6H2,(H,17,18)/t8-/m1/s1.
What are the key properties of (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid?
(2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid has a molecular weight of 251.24 g/mol, XLogP of 0.79, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(2,3-dihydroxybenzoyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 104894003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).